C14H16BrN5O — CID 119410041
[(3R)-3-aminopyrrolidin-1-yl]-[1-(3-bromophenyl)-5-methyltriazol-4-yl]methanone (PubChem CID 119410041) has the molecular formula C14H16BrN5O and a molecular weight of 350.22 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[1-(3-bromophenyl)-5-methyltriazol-4-yl]methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-(3-bromophenyl)-5-methyltriazol-4-yl]methanone |
|---|---|
| PubChem CID | 119410041 |
| Molecular Formula | C14H16BrN5O |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-(3-bromophenyl)-5-methyltriazol-4-yl]methanone |
| SMILES | Cc1c(C(=O)N2CC[C@@H](N)C2)nnn1-c1cccc(Br)c1 |
| InChI | InChI=1S/C14H16BrN5O/c1-9-13(14(21)19-6-5-11(16)8-19)17-18-20(9)12-4-2-3-10(15)7-12/h2-4,7,11H,5-6,8,16H2,1H3/t11-/m1/s1 |
| InChIKey | JXGTZYFYLAORLH-LLVKDONJSA-N |
| XLogP | 1.51 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |