C18H22Cl2N6O — CID 119373681
(4-aminopiperidin-1-yl)-(5-methyl-1-quinolin-6-yltriazol-4-yl)methanone;dihydrochloride (PubChem CID 119373681) has the molecular formula C18H22Cl2N6O and a molecular weight of 409.32 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-(5-methyl-1-quinolin-6-yltriazol-4-yl)methanone;dihydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-(5-methyl-1-quinolin-6-yltriazol-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119373681 |
| Molecular Formula | C18H22Cl2N6O |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (4-aminopiperidin-1-yl)-(5-methyl-1-quinolin-6-yltriazol-4-yl)methanone;dihydrochloride |
| SMILES | Cc1c(C(=O)N2CCC(N)CC2)nnn1-c1ccc2ncccc2c1.Cl.Cl |
| InChI | InChI=1S/C18H20N6O.2ClH/c1-12-17(18(25)23-9-6-14(19)7-10-23)21-22-24(12)15-4-5-16-13(11-15)3-2-8-20-16;;/h2-5,8,11,14H,6-7,9-10,19H2,1H3;2*1H |
| InChIKey | LQMOEGGDDAATJU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |