C21H24N6O — CID 146088736
(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(5-methyl-1-quinolin-6-yltriazol-4-yl)methanone (PubChem CID 146088736) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(5-methyl-1-quinolin-6-yltriazol-4-yl)methanone.
| Compound Name | (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(5-methyl-1-quinolin-6-yltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 146088736 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(5-methyl-1-quinolin-6-yltriazol-4-yl)methanone |
| SMILES | Cc1c(C(=O)N2CC3CCCC(N)C3C2)nnn1-c1ccc2ncccc2c1 |
| InChI | InChI=1S/C21H24N6O/c1-13-20(21(28)26-11-15-4-2-6-18(22)17(15)12-26)24-25-27(13)16-7-8-19-14(10-16)5-3-9-23-19/h3,5,7-10,15,17-18H,2,4,6,11-12,22H2,1H3 |
| InChIKey | XKXUZUPICZNMBM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |