About N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide
N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide (PubChem CID 126808264) has the molecular formula C20H21F2N5O
and a molecular weight of 385.42 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide |
| PubChem CID | 126808264 |
| Molecular Formula | C20H21F2N5O |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C2CCC(F)(F)CC2)nnn1-c1ccc2ncccc2c1 |
| InChI | InChI=1S/C20H21F2N5O/c1-13-18(19(28)26(2)15-7-9-20(21,22)10-8-15)24-25-27(13)16-5-6-17-14(12-16)4-3-11-23-17/h3-6,11-12,15H,7-10H2,1-2H3 |
| InChIKey | VPPKONAACCZGLQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide?
The IUPAC name of N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide (CID 126808264) is N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide?
The canonical SMILES for N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide is Cc1c(C(=O)N(C)C2CCC(F)(F)CC2)nnn1-c1ccc2ncccc2c1.
What is the InChIKey of N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide?
The InChIKey is VPPKONAACCZGLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21F2N5O/c1-13-18(19(28)26(2)15-7-9-20(21,22)10-8-15)24-25-27(13)16-5-6-17-14(12-16)4-3-11-23-17/h3-6,11-12,15H,7-10H2,1-2H3.
What are the key properties of N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide?
N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide has a molecular weight of 385.42 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)-N,5-dimethyl-1-quinolin-6-yltriazole-4-carboxamide is sourced from PubChem (CID 126808264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).