C19H22N6O — CID 119441874
N,5-dimethyl-N-piperidin-4-yl-1-quinolin-6-yltriazole-4-carboxamide (PubChem CID 119441874) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is N,5-dimethyl-N-piperidin-4-yl-1-quinolin-6-yltriazole-4-carboxamide.
| Compound Name | N,5-dimethyl-N-piperidin-4-yl-1-quinolin-6-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119441874 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N,5-dimethyl-N-piperidin-4-yl-1-quinolin-6-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C2CCNCC2)nnn1-c1ccc2ncccc2c1 |
| InChI | InChI=1S/C19H22N6O/c1-13-18(19(26)24(2)15-7-10-20-11-8-15)22-23-25(13)16-5-6-17-14(12-16)4-3-9-21-17/h3-6,9,12,15,20H,7-8,10-11H2,1-2H3 |
| InChIKey | AKGYJQQRNGTWMC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |