C19H25Cl2N7O — CID 119445748
5-methyl-N-(2-piperazin-1-ylethyl)-1-quinolin-6-yltriazole-4-carboxamide;dihydrochloride (PubChem CID 119445748) has the molecular formula C19H25Cl2N7O and a molecular weight of 438.36 g/mol. Its IUPAC name is 5-methyl-N-(2-piperazin-1-ylethyl)-1-quinolin-6-yltriazole-4-carboxamide;dihydrochloride.
| Compound Name | 5-methyl-N-(2-piperazin-1-ylethyl)-1-quinolin-6-yltriazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119445748 |
| Molecular Formula | C19H25Cl2N7O |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 5-methyl-N-(2-piperazin-1-ylethyl)-1-quinolin-6-yltriazole-4-carboxamide;dihydrochloride |
| SMILES | Cc1c(C(=O)NCCN2CCNCC2)nnn1-c1ccc2ncccc2c1.Cl.Cl |
| InChI | InChI=1S/C19H23N7O.2ClH/c1-14-18(19(27)22-9-12-25-10-7-20-8-11-25)23-24-26(14)16-4-5-17-15(13-16)3-2-6-21-17;;/h2-6,13,20H,7-12H2,1H3,(H,22,27);2*1H |
| InChIKey | RCULNYWMRHWAIK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |