C17H24N6O2 — CID 119445642
1-(4-methoxyphenyl)-5-methyl-N-(2-piperazin-1-ylethyl)triazole-4-carboxamide (PubChem CID 119445642) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-methyl-N-(2-piperazin-1-ylethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-5-methyl-N-(2-piperazin-1-ylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 119445642 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-methyl-N-(2-piperazin-1-ylethyl)triazole-4-carboxamide |
| SMILES | COc1ccc(-n2nnc(C(=O)NCCN3CCNCC3)c2C)cc1 |
| InChI | InChI=1S/C17H24N6O2/c1-13-16(17(24)19-9-12-22-10-7-18-8-11-22)20-21-23(13)14-3-5-15(25-2)6-4-14/h3-6,18H,7-12H2,1-2H3,(H,19,24) |
| InChIKey | FIBFVTKXELZLIT-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |