C19H27N5O3 — CID 23610595
1-(4-ethoxyphenyl)-5-methyl-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide (PubChem CID 23610595) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-5-methyl-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide.
| Compound Name | 1-(4-ethoxyphenyl)-5-methyl-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 23610595 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 1-(4-ethoxyphenyl)-5-methyl-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide |
| SMILES | CCOc1ccc(-n2nnc(C(=O)NCCCN3CCOCC3)c2C)cc1 |
| InChI | InChI=1S/C19H27N5O3/c1-3-27-17-7-5-16(6-8-17)24-15(2)18(21-22-24)19(25)20-9-4-10-23-11-13-26-14-12-23/h5-8H,3-4,9-14H2,1-2H3,(H,20,25) |
| InChIKey | MEDMGBKFBOXQIW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|