C20H27N3O3S — CID 43045174
4-methyl-2-[(4-methylphenoxy)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 43045174) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-methyl-2-[(4-methylphenoxy)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-2-[(4-methylphenoxy)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 43045174 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-methyl-2-[(4-methylphenoxy)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ccc(OCc2nc(C)c(C(=O)NCCCN3CCOCC3)s2)cc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-15-4-6-17(7-5-15)26-14-18-22-16(2)19(27-18)20(24)21-8-3-9-23-10-12-25-13-11-23/h4-7H,3,8-14H2,1-2H3,(H,21,24) |
| InChIKey | XWLCNPWEBVKNOW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|