C21H19Cl2N3O3S — CID 55546254
N-[2-[(4-chlorobenzoyl)amino]ethyl]-2-[(4-chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 55546254) has the molecular formula C21H19Cl2N3O3S and a molecular weight of 464.37 g/mol. Its IUPAC name is N-[2-[(4-chlorobenzoyl)amino]ethyl]-2-[(4-chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-2-[(4-chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55546254 |
| Molecular Formula | C21H19Cl2N3O3S |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | N-[2-[(4-chlorobenzoyl)amino]ethyl]-2-[(4-chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(COc2ccc(Cl)cc2)sc1C(=O)NCCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19Cl2N3O3S/c1-13-19(30-18(26-13)12-29-17-8-6-16(23)7-9-17)21(28)25-11-10-24-20(27)14-2-4-15(22)5-3-14/h2-9H,10-12H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | WXOSKIKNWKXRHH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|