C17H22N2O3S — CID 50746403
2-[(3,4-dimethylphenoxy)methyl]-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 50746403) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenoxy)methyl]-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(3,4-dimethylphenoxy)methyl]-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 50746403 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-[(3,4-dimethylphenoxy)methyl]-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COCCNC(=O)c1sc(COc2ccc(C)c(C)c2)nc1C |
| InChI | InChI=1S/C17H22N2O3S/c1-11-5-6-14(9-12(11)2)22-10-15-19-13(3)16(23-15)17(20)18-7-8-21-4/h5-6,9H,7-8,10H2,1-4H3,(H,18,20) |
| InChIKey | PJVYLRCYQJQFFT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|