C16H17ClN2O2S — CID 46741139
2-[(4-chloro-3-methylphenoxy)methyl]-4-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide (PubChem CID 46741139) has the molecular formula C16H17ClN2O2S and a molecular weight of 336.84 g/mol. Its IUPAC name is 2-[(4-chloro-3-methylphenoxy)methyl]-4-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(4-chloro-3-methylphenoxy)methyl]-4-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46741139 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[(4-chloro-3-methylphenoxy)methyl]-4-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide |
| SMILES | C=CCNC(=O)c1sc(COc2ccc(Cl)c(C)c2)nc1C |
| InChI | InChI=1S/C16H17ClN2O2S/c1-4-7-18-16(20)15-11(3)19-14(22-15)9-21-12-5-6-13(17)10(2)8-12/h4-6,8H,1,7,9H2,2-3H3,(H,18,20) |
| InChIKey | SQCUMEHAHZYTSL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|