C18H24BrN5O — CID 46858193
1-(4-bromo-3-methylphenyl)-5-methyl-N-(2-piperidin-1-ylethyl)triazole-4-carboxamide (PubChem CID 46858193) has the molecular formula C18H24BrN5O and a molecular weight of 406.33 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-5-methyl-N-(2-piperidin-1-ylethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-bromo-3-methylphenyl)-5-methyl-N-(2-piperidin-1-ylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 46858193 |
| Molecular Formula | C18H24BrN5O |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-5-methyl-N-(2-piperidin-1-ylethyl)triazole-4-carboxamide |
| SMILES | Cc1cc(-n2nnc(C(=O)NCCN3CCCCC3)c2C)ccc1Br |
| InChI | InChI=1S/C18H24BrN5O/c1-13-12-15(6-7-16(13)19)24-14(2)17(21-22-24)18(25)20-8-11-23-9-4-3-5-10-23/h6-7,12H,3-5,8-11H2,1-2H3,(H,20,25) |
| InChIKey | CMFUGIOSPOKXRH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |