C16H15BrN4OS — CID 46858176
1-(4-bromo-3-methylphenyl)-5-methyl-N-(thiophen-2-ylmethyl)triazole-4-carboxamide (PubChem CID 46858176) has the molecular formula C16H15BrN4OS and a molecular weight of 391.29 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-5-methyl-N-(thiophen-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-bromo-3-methylphenyl)-5-methyl-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 46858176 |
| Molecular Formula | C16H15BrN4OS |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-5-methyl-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
| SMILES | Cc1cc(-n2nnc(C(=O)NCc3cccs3)c2C)ccc1Br |
| InChI | InChI=1S/C16H15BrN4OS/c1-10-8-12(5-6-14(10)17)21-11(2)15(19-20-21)16(22)18-9-13-4-3-7-23-13/h3-8H,9H2,1-2H3,(H,18,22) |
| InChIKey | LQSMDEDVQDASGI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |