C14H12FN5OS — CID 6498277
5-amino-1-(4-fluorophenyl)-N-(thiophen-2-ylmethyl)triazole-4-carboxamide (PubChem CID 6498277) has the molecular formula C14H12FN5OS and a molecular weight of 317.35 g/mol. Its IUPAC name is 5-amino-1-(4-fluorophenyl)-N-(thiophen-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | 5-amino-1-(4-fluorophenyl)-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 6498277 |
| Molecular Formula | C14H12FN5OS |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 5-amino-1-(4-fluorophenyl)-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
| SMILES | Nc1c(C(=O)NCc2cccs2)nnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H12FN5OS/c15-9-3-5-10(6-4-9)20-13(16)12(18-19-20)14(21)17-8-11-2-1-7-22-11/h1-7H,8,16H2,(H,17,21) |
| InChIKey | GXMWXXRVYIVQQE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |