C16H15N5O — CID 17015753
5-amino-N-benzyl-1-phenyltriazole-4-carboxamide (PubChem CID 17015753) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is 5-amino-N-benzyl-1-phenyltriazole-4-carboxamide.
| Compound Name | 5-amino-N-benzyl-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 17015753 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 5-amino-N-benzyl-1-phenyltriazole-4-carboxamide |
| SMILES | Nc1c(C(=O)NCc2ccccc2)nnn1-c1ccccc1 |
| InChI | InChI=1S/C16H15N5O/c17-15-14(16(22)18-11-12-7-3-1-4-8-12)19-20-21(15)13-9-5-2-6-10-13/h1-10H,11,17H2,(H,18,22) |
| InChIKey | KIDRBCIRDJDFME-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |