C14H12BrN5O2 — CID 17015687
5-amino-1-(4-bromophenyl)-N-(furan-2-ylmethyl)triazole-4-carboxamide (PubChem CID 17015687) has the molecular formula C14H12BrN5O2 and a molecular weight of 362.19 g/mol. Its IUPAC name is 5-amino-1-(4-bromophenyl)-N-(furan-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | 5-amino-1-(4-bromophenyl)-N-(furan-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 17015687 |
| Molecular Formula | C14H12BrN5O2 |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 5-amino-1-(4-bromophenyl)-N-(furan-2-ylmethyl)triazole-4-carboxamide |
| SMILES | Nc1c(C(=O)NCc2ccco2)nnn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H12BrN5O2/c15-9-3-5-10(6-4-9)20-13(16)12(18-19-20)14(21)17-8-11-2-1-7-22-11/h1-7H,8,16H2,(H,17,21) |
| InChIKey | WJMQTSMBJPOXOG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |