C8H9N5O2 — CID 110484783
5-amino-N-(furan-2-ylmethyl)-2H-triazole-4-carboxamide (PubChem CID 110484783) has the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. Its IUPAC name is 5-amino-N-(furan-2-ylmethyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-amino-N-(furan-2-ylmethyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 110484783 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 5-amino-N-(furan-2-ylmethyl)-2H-triazole-4-carboxamide |
| SMILES | Nc1n[nH]nc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C8H9N5O2/c9-7-6(11-13-12-7)8(14)10-4-5-2-1-3-15-5/h1-3H,4H2,(H,10,14)(H3,9,11,12,13) |
| InChIKey | ORPVXIBKVIKWSX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |