C11H10ClN3O2 — CID 62156043
6-amino-5-chloro-N-(furan-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 62156043) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is 6-amino-5-chloro-N-(furan-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 6-amino-5-chloro-N-(furan-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62156043 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 6-amino-5-chloro-N-(furan-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | Nc1ncc(C(=O)NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C11H10ClN3O2/c12-9-4-7(5-14-10(9)13)11(16)15-6-8-2-1-3-17-8/h1-5H,6H2,(H2,13,14)(H,15,16) |
| InChIKey | APICQPVVQNBZJH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |