C18H16N2O4 — CID 743261
1-N,3-N-bis(furan-2-ylmethyl)benzene-1,3-dicarboxamide (PubChem CID 743261) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-N,3-N-bis(furan-2-ylmethyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(furan-2-ylmethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 743261 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-N,3-N-bis(furan-2-ylmethyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(NCc1ccco1)c1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C18H16N2O4/c21-17(19-11-15-6-2-8-23-15)13-4-1-5-14(10-13)18(22)20-12-16-7-3-9-24-16/h1-10H,11-12H2,(H,19,21)(H,20,22) |
| InChIKey | HAWCEPIYINSJTA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |