C15H12FN3O2 — CID 19514521
5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-1H-pyrazole-3-carboxamide (PubChem CID 19514521) has the molecular formula C15H12FN3O2 and a molecular weight of 285.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(furan-2-ylmethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19514521 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(furan-2-ylmethyl)-1H-pyrazole-5-carboxamide |
| SMILES | C1=COC(=C1)CNC(=O)C2=CC(=NN2)C3=CC=C(C=C3)F |
| InChI | InChI=1S/C15H12FN3O2/c16-11-5-3-10(4-6-11)13-8-14(19-18-13)15(20)17-9-12-2-1-7-21-12/h1-8H,9H2,(H,17,20)(H,18,19) |
| InChIKey | CEKLSLPGZUGGKB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 361 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |