C23H18FN3O3 — CID 9079495
2-(4-fluorophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]quinoline-4-carboxamide (PubChem CID 9079495) has the molecular formula C23H18FN3O3 and a molecular weight of 403.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 9079495 |
| Molecular Formula | C23H18FN3O3 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]quinoline-4-carboxamide |
| SMILES | O=C(CNC(=O)c1cc(-c2ccc(F)cc2)nc2ccccc12)NCc1ccco1 |
| InChI | InChI=1S/C23H18FN3O3/c24-16-9-7-15(8-10-16)21-12-19(18-5-1-2-6-20(18)27-21)23(29)26-14-22(28)25-13-17-4-3-11-30-17/h1-12H,13-14H2,(H,25,28)(H,26,29) |
| InChIKey | QOCNTQDGMVJHBR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |