C20H15N3O2 — CID 3241370
N-(furan-2-ylmethyl)-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 3241370) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3241370 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | O=C(NCc1ccco1)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C20H15N3O2/c24-20(22-13-15-4-3-11-25-15)17-12-19(14-7-9-21-10-8-14)23-18-6-2-1-5-16(17)18/h1-12H,13H2,(H,22,24) |
| InChIKey | BBCANISUVWZIAE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |