C21H17N3O3S — CID 9080200
N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 9080200) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 9080200 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(CNC(=O)c1cc(-c2cccs2)nc2ccccc12)NCc1ccco1 |
| InChI | InChI=1S/C21H17N3O3S/c25-20(22-12-14-5-3-9-27-14)13-23-21(26)16-11-18(19-8-4-10-28-19)24-17-7-2-1-6-15(16)17/h1-11H,12-13H2,(H,22,25)(H,23,26) |
| InChIKey | MIGOTUVHRHRECU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |