C21H15ClN2O4S — CID 2570075
[2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(5-chlorothiophen-2-yl)quinoline-4-carboxylate (PubChem CID 2570075) has the molecular formula C21H15ClN2O4S and a molecular weight of 426.88 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(5-chlorothiophen-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(5-chlorothiophen-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2570075 |
| Molecular Formula | C21H15ClN2O4S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-(5-chlorothiophen-2-yl)quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(Cl)s2)nc2ccccc12)NCc1ccco1 |
| InChI | InChI=1S/C21H15ClN2O4S/c22-19-8-7-18(29-19)17-10-15(14-5-1-2-6-16(14)24-17)21(26)28-12-20(25)23-11-13-4-3-9-27-13/h1-10H,11-12H2,(H,23,25) |
| InChIKey | BXNBSEVTFJGFHO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |