C31H22Cl2N4O2S2 — CID 3689968
2-(5-chlorothiophen-2-yl)-N-[3-[[2-(5-chlorothiophen-2-yl)quinoline-4-carbonyl]amino]propyl]quinoline-4-carboxamide (PubChem CID 3689968) has the molecular formula C31H22Cl2N4O2S2 and a molecular weight of 617.58 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-[3-[[2-(5-chlorothiophen-2-yl)quinoline-4-carbonyl]amino]propyl]quinoline-4-carboxamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-[3-[[2-(5-chlorothiophen-2-yl)quinoline-4-carbonyl]amino]propyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3689968 |
| Molecular Formula | C31H22Cl2N4O2S2 |
| Molecular Weight | 617.58 g/mol |
| Exact Mass | 616.06 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-[3-[[2-(5-chlorothiophen-2-yl)quinoline-4-carbonyl]amino]propyl]quinoline-4-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1cc(-c2ccc(Cl)s2)nc2ccccc12)c1cc(-c2ccc(Cl)s2)nc2ccccc12 |
| InChI | InChI=1S/C31H22Cl2N4O2S2/c32-28-12-10-26(40-28)24-16-20(18-6-1-3-8-22(18)36-24)30(38)34-14-5-15-35-31(39)21-17-25(27-11-13-29(33)41-27)37-23-9-4-2-7-19(21)23/h1-4,6-13,16-17H,5,14-15H2,(H,34,38)(H,35,39) |
| InChIKey | PZXGBAVPSQSNLB-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.58 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|