C22H17ClN2OS — CID 3457981
2-(5-chlorothiophen-2-yl)-N-(2-ethylphenyl)quinoline-4-carboxamide (PubChem CID 3457981) has the molecular formula C22H17ClN2OS and a molecular weight of 392.91 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-(2-ethylphenyl)quinoline-4-carboxamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-(2-ethylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3457981 |
| Molecular Formula | C22H17ClN2OS |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-(2-ethylphenyl)quinoline-4-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1cc(-c2ccc(Cl)s2)nc2ccccc12 |
| InChI | InChI=1S/C22H17ClN2OS/c1-2-14-7-3-5-9-17(14)25-22(26)16-13-19(20-11-12-21(23)27-20)24-18-10-6-4-8-15(16)18/h3-13H,2H2,1H3,(H,25,26) |
| InChIKey | ZWLDVRFVBUQSBW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |