C19H19ClN2OS — CID 4163216
2-(5-chlorothiophen-2-yl)-N-pentylquinoline-4-carboxamide (PubChem CID 4163216) has the molecular formula C19H19ClN2OS and a molecular weight of 358.89 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-pentylquinoline-4-carboxamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-pentylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4163216 |
| Molecular Formula | C19H19ClN2OS |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-pentylquinoline-4-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(-c2ccc(Cl)s2)nc2ccccc12 |
| InChI | InChI=1S/C19H19ClN2OS/c1-2-3-6-11-21-19(23)14-12-16(17-9-10-18(20)24-17)22-15-8-5-4-7-13(14)15/h4-5,7-10,12H,2-3,6,11H2,1H3,(H,21,23) |
| InChIKey | IPZUNKCFIQNHNY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|