C21H24BrN3OS — CID 15996066
2-(5-bromothiophen-2-yl)-N-[2-[butyl(methyl)amino]ethyl]quinoline-4-carboxamide (PubChem CID 15996066) has the molecular formula C21H24BrN3OS and a molecular weight of 446.41 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-N-[2-[butyl(methyl)amino]ethyl]quinoline-4-carboxamide.
| Compound Name | 2-(5-bromothiophen-2-yl)-N-[2-[butyl(methyl)amino]ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 15996066 |
| Molecular Formula | C21H24BrN3OS |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-N-[2-[butyl(methyl)amino]ethyl]quinoline-4-carboxamide |
| SMILES | CCCCN(C)CCNC(=O)c1cc(-c2ccc(Br)s2)nc2ccccc12 |
| InChI | InChI=1S/C21H24BrN3OS/c1-3-4-12-25(2)13-11-23-21(26)16-14-18(19-9-10-20(22)27-19)24-17-8-6-5-7-15(16)17/h5-10,14H,3-4,11-13H2,1-2H3,(H,23,26) |
| InChIKey | CXGSFPPGEVHLGN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |