C23H26BrN3OS — CID 15993577
2-(5-bromothiophen-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]quinoline-4-carboxamide (PubChem CID 15993577) has the molecular formula C23H26BrN3OS and a molecular weight of 472.45 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]quinoline-4-carboxamide.
| Compound Name | 2-(5-bromothiophen-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 15993577 |
| Molecular Formula | C23H26BrN3OS |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]quinoline-4-carboxamide |
| SMILES | CC1CCCCN1CCCNC(=O)c1cc(-c2ccc(Br)s2)nc2ccccc12 |
| InChI | InChI=1S/C23H26BrN3OS/c1-16-7-4-5-13-27(16)14-6-12-25-23(28)18-15-20(21-10-11-22(24)29-21)26-19-9-3-2-8-17(18)19/h2-3,8-11,15-16H,4-7,12-14H2,1H3,(H,25,28) |
| InChIKey | BBSHGNBBZYQYHI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|