C16H23BrN2OS — CID 107020528
4-bromo-N-[3-(2-methylpiperidin-1-yl)propyl]-2-sulfanylbenzamide (PubChem CID 107020528) has the molecular formula C16H23BrN2OS and a molecular weight of 371.34 g/mol. Its IUPAC name is 4-bromo-N-[3-(2-methylpiperidin-1-yl)propyl]-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-[3-(2-methylpiperidin-1-yl)propyl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107020528 |
| Molecular Formula | C16H23BrN2OS |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 4-bromo-N-[3-(2-methylpiperidin-1-yl)propyl]-2-sulfanylbenzamide |
| SMILES | CC1CCCCN1CCCNC(=O)c1ccc(Br)cc1S |
| InChI | InChI=1S/C16H23BrN2OS/c1-12-5-2-3-9-19(12)10-4-8-18-16(20)14-7-6-13(17)11-15(14)21/h6-7,11-12,21H,2-5,8-10H2,1H3,(H,18,20) |
| InChIKey | CSYQYYFDPZOUND-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|