C13H17BrN2OS — CID 107024007
4-bromo-N-[3-(cyclopropylamino)propyl]-2-sulfanylbenzamide (PubChem CID 107024007) has the molecular formula C13H17BrN2OS and a molecular weight of 329.26 g/mol. Its IUPAC name is 4-bromo-N-[3-(cyclopropylamino)propyl]-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-[3-(cyclopropylamino)propyl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107024007 |
| Molecular Formula | C13H17BrN2OS |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 4-bromo-N-[3-(cyclopropylamino)propyl]-2-sulfanylbenzamide |
| SMILES | O=C(NCCCNC1CC1)c1ccc(Br)cc1S |
| InChI | InChI=1S/C13H17BrN2OS/c14-9-2-5-11(12(18)8-9)13(17)16-7-1-6-15-10-3-4-10/h2,5,8,10,15,18H,1,3-4,6-7H2,(H,16,17) |
| InChIKey | KJSUGRRLPAOHJY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|