C13H16BrClN2O — CID 43596539
5-bromo-2-chloro-N-[3-(cyclopropylamino)propyl]benzamide (PubChem CID 43596539) has the molecular formula C13H16BrClN2O and a molecular weight of 331.64 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[3-(cyclopropylamino)propyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[3-(cyclopropylamino)propyl]benzamide |
|---|---|
| PubChem CID | 43596539 |
| Molecular Formula | C13H16BrClN2O |
| Molecular Weight | 331.64 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 5-bromo-2-chloro-N-[3-(cyclopropylamino)propyl]benzamide |
| SMILES | O=C(NCCCNC1CC1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C13H16BrClN2O/c14-9-2-5-12(15)11(8-9)13(18)17-7-1-6-16-10-3-4-10/h2,5,8,10,16H,1,3-4,6-7H2,(H,17,18) |
| InChIKey | FYWRCGKXLYBQOU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|