C16H13BrCl2N2O2 — CID 55659264
5-bromo-2-chloro-N-[2-[(2-chlorobenzoyl)amino]ethyl]benzamide (PubChem CID 55659264) has the molecular formula C16H13BrCl2N2O2 and a molecular weight of 416.10 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[2-[(2-chlorobenzoyl)amino]ethyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[2-[(2-chlorobenzoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55659264 |
| Molecular Formula | C16H13BrCl2N2O2 |
| Molecular Weight | 416.10 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 5-bromo-2-chloro-N-[2-[(2-chlorobenzoyl)amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1cc(Br)ccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C16H13BrCl2N2O2/c17-10-5-6-14(19)12(9-10)16(23)21-8-7-20-15(22)11-3-1-2-4-13(11)18/h1-6,9H,7-8H2,(H,20,22)(H,21,23) |
| InChIKey | KEJRKJLKPQHTTR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.10 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|