C10H13BrCl2N2O — CID 119503330
5-bromo-2-chloro-N-[2-(methylamino)ethyl]benzamide;hydrochloride (PubChem CID 119503330) has the molecular formula C10H13BrCl2N2O and a molecular weight of 328.04 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[2-(methylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 5-bromo-2-chloro-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119503330 |
| Molecular Formula | C10H13BrCl2N2O |
| Molecular Weight | 328.04 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | 5-bromo-2-chloro-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
| SMILES | CNCCNC(=O)c1cc(Br)ccc1Cl.Cl |
| InChI | InChI=1S/C10H12BrClN2O.ClH/c1-13-4-5-14-10(15)8-6-7(11)2-3-9(8)12;/h2-3,6,13H,4-5H2,1H3,(H,14,15);1H |
| InChIKey | XHHHFRVUIQHWAB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.04 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|