C14H17BrClNO3 — CID 43240050
7-[(5-bromo-2-chlorobenzoyl)amino]heptanoic acid (PubChem CID 43240050) has the molecular formula C14H17BrClNO3 and a molecular weight of 362.65 g/mol. Its IUPAC name is 7-[(5-bromo-2-chlorobenzoyl)amino]heptanoic acid.
| Compound Name | 7-[(5-bromo-2-chlorobenzoyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 43240050 |
| Molecular Formula | C14H17BrClNO3 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 7-[(5-bromo-2-chlorobenzoyl)amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C14H17BrClNO3/c15-10-6-7-12(16)11(9-10)14(20)17-8-4-2-1-3-5-13(18)19/h6-7,9H,1-5,8H2,(H,17,20)(H,18,19) |
| InChIKey | SBFTXOVGBADXNB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|