C11H11BrINO3 — CID 43239229
4-[(5-bromo-2-iodobenzoyl)amino]butanoic acid (PubChem CID 43239229) has the molecular formula C11H11BrINO3 and a molecular weight of 412.02 g/mol. Its IUPAC name is 4-[(5-bromo-2-iodobenzoyl)amino]butanoic acid.
| Compound Name | 4-[(5-bromo-2-iodobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43239229 |
| Molecular Formula | C11H11BrINO3 |
| Molecular Weight | 412.02 g/mol |
| Exact Mass | 410.90 |
| IUPAC Name | 4-[(5-bromo-2-iodobenzoyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1cc(Br)ccc1I |
| InChI | InChI=1S/C11H11BrINO3/c12-7-3-4-9(13)8(6-7)11(17)14-5-1-2-10(15)16/h3-4,6H,1-2,5H2,(H,14,17)(H,15,16) |
| InChIKey | AYYUUGTWBHPREE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.02 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|