C9H7BrClF2NO — CID 79079697
5-bromo-2-chloro-N-(2,2-difluoroethyl)benzamide (PubChem CID 79079697) has the molecular formula C9H7BrClF2NO and a molecular weight of 298.51 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2,2-difluoroethyl)benzamide.
| Compound Name | 5-bromo-2-chloro-N-(2,2-difluoroethyl)benzamide |
|---|---|
| PubChem CID | 79079697 |
| Molecular Formula | C9H7BrClF2NO |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 296.94 |
| IUPAC Name | 5-bromo-2-chloro-N-(2,2-difluoroethyl)benzamide |
| SMILES | O=C(NCC(F)F)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C9H7BrClF2NO/c10-5-1-2-7(11)6(3-5)9(15)14-4-8(12)13/h1-3,8H,4H2,(H,14,15) |
| InChIKey | SASOEQWGBMXBFI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |