C11H16BrClN2O — CID 119500891
5-bromo-2-methyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride (PubChem CID 119500891) has the molecular formula C11H16BrClN2O and a molecular weight of 307.62 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 5-bromo-2-methyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119500891 |
| Molecular Formula | C11H16BrClN2O |
| Molecular Weight | 307.62 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 5-bromo-2-methyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
| SMILES | CNCCNC(=O)c1cc(Br)ccc1C.Cl |
| InChI | InChI=1S/C11H15BrN2O.ClH/c1-8-3-4-9(12)7-10(8)11(15)14-6-5-13-2;/h3-4,7,13H,5-6H2,1-2H3,(H,14,15);1H |
| InChIKey | SSACOPHVWDRUFM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.62 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|