C11H13BrN2O2 — CID 65306886
5-bromo-2-methyl-N-[2-(methylamino)-2-oxoethyl]benzamide (PubChem CID 65306886) has the molecular formula C11H13BrN2O2 and a molecular weight of 285.14 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-[2-(methylamino)-2-oxoethyl]benzamide.
| Compound Name | 5-bromo-2-methyl-N-[2-(methylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 65306886 |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 5-bromo-2-methyl-N-[2-(methylamino)-2-oxoethyl]benzamide |
| SMILES | CNC(=O)CNC(=O)c1cc(Br)ccc1C |
| InChI | InChI=1S/C11H13BrN2O2/c1-7-3-4-8(12)5-9(7)11(16)14-6-10(15)13-2/h3-5H,6H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | KBUNCCVWACSJDB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |