C10H12BrN3O2 — CID 79714359
2-amino-4-bromo-N-[2-(methylamino)-2-oxoethyl]benzamide (PubChem CID 79714359) has the molecular formula C10H12BrN3O2 and a molecular weight of 286.13 g/mol. Its IUPAC name is 2-amino-4-bromo-N-[2-(methylamino)-2-oxoethyl]benzamide.
| Compound Name | 2-amino-4-bromo-N-[2-(methylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 79714359 |
| Molecular Formula | C10H12BrN3O2 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 2-amino-4-bromo-N-[2-(methylamino)-2-oxoethyl]benzamide |
| SMILES | CNC(=O)CNC(=O)c1ccc(Br)cc1N |
| InChI | InChI=1S/C10H12BrN3O2/c1-13-9(15)5-14-10(16)7-3-2-6(11)4-8(7)12/h2-4H,5,12H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | RGHKTPBWJUDKBQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|