C12H17BrN2O2 — CID 113495833
2-amino-4-bromo-N-(2-hydroxypentyl)benzamide (PubChem CID 113495833) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-amino-4-bromo-N-(2-hydroxypentyl)benzamide.
| Compound Name | 2-amino-4-bromo-N-(2-hydroxypentyl)benzamide |
|---|---|
| PubChem CID | 113495833 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-amino-4-bromo-N-(2-hydroxypentyl)benzamide |
| SMILES | CCCC(O)CNC(=O)c1ccc(Br)cc1N |
| InChI | InChI=1S/C12H17BrN2O2/c1-2-3-9(16)7-15-12(17)10-5-4-8(13)6-11(10)14/h4-6,9,16H,2-3,7,14H2,1H3,(H,15,17) |
| InChIKey | FGOAPFRXGOPWAJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|