C11H15N3O2 — CID 43310303
3-amino-2-methyl-N-[2-(methylamino)-2-oxoethyl]benzamide (PubChem CID 43310303) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-amino-2-methyl-N-[2-(methylamino)-2-oxoethyl]benzamide.
| Compound Name | 3-amino-2-methyl-N-[2-(methylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 43310303 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-amino-2-methyl-N-[2-(methylamino)-2-oxoethyl]benzamide |
| SMILES | CNC(=O)CNC(=O)c1cccc(N)c1C |
| InChI | InChI=1S/C11H15N3O2/c1-7-8(4-3-5-9(7)12)11(16)14-6-10(15)13-2/h3-5H,6,12H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | VIXUOPSWOWWWIH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|