C12H19ClN2O — CID 119502208
2,5-dimethyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride (PubChem CID 119502208) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 2,5-dimethyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119502208 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2,5-dimethyl-N-[2-(methylamino)ethyl]benzamide;hydrochloride |
| SMILES | CNCCNC(=O)c1cc(C)ccc1C.Cl |
| InChI | InChI=1S/C12H18N2O.ClH/c1-9-4-5-10(2)11(8-9)12(15)14-7-6-13-3;/h4-5,8,13H,6-7H2,1-3H3,(H,14,15);1H |
| InChIKey | XAYFDYTWBOAHJP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|