C17H24ClN3O — CID 119502830
2,5-dimethyl-N-[2-(methylamino)ethyl]-1-(3-methylphenyl)pyrrole-3-carboxamide;hydrochloride (PubChem CID 119502830) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-(methylamino)ethyl]-1-(3-methylphenyl)pyrrole-3-carboxamide;hydrochloride.
| Compound Name | 2,5-dimethyl-N-[2-(methylamino)ethyl]-1-(3-methylphenyl)pyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119502830 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2,5-dimethyl-N-[2-(methylamino)ethyl]-1-(3-methylphenyl)pyrrole-3-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)c1cc(C)n(-c2cccc(C)c2)c1C.Cl |
| InChI | InChI=1S/C17H23N3O.ClH/c1-12-6-5-7-15(10-12)20-13(2)11-16(14(20)3)17(21)19-9-8-18-4;/h5-7,10-11,18H,8-9H2,1-4H3,(H,19,21);1H |
| InChIKey | CCPKCCATHWDVRZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|