2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid

C14H15NO2 — CID 2339295

IUPAC2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid
SMILESCc1cccc(-n2c(C)cc(C(=O)O)c2C)c1
InChIInChI=1S/C14H15NO2/c1-9-5-4-6-12(7-9)15-10(2)8-13(11(15)3)14(16)17/h4-8H,1-3H3,(H,16,17)
InChIKeyIOJALCGKYLGWBU-UHFFFAOYSA-N
MW229.28 g/mol
LogP3.10
Rot. Bonds2

About 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid

2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid (PubChem CID 2339295) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid.

Molecular Properties

Compound Name2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid
PubChem CID2339295
Molecular FormulaC14H15NO2
Molecular Weight229.28 g/mol
Exact Mass229.11
IUPAC Name2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid
SMILESCc1cccc(-n2c(C)cc(C(=O)O)c2C)c1
InChIInChI=1S/C14H15NO2/c1-9-5-4-6-12(7-9)15-10(2)8-13(11(15)3)14(16)17/h4-8H,1-3H3,(H,16,17)
InChIKeyIOJALCGKYLGWBU-UHFFFAOYSA-N
XLogP3.10
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.28
LogP ≤ 53.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}

Analyze 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid?
The IUPAC name of 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid (CID 2339295) is 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid.
What is the SMILES notation for 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid?
The canonical SMILES for 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid is Cc1cccc(-n2c(C)cc(C(=O)O)c2C)c1.
What is the InChIKey of 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid?
The InChIKey is IOJALCGKYLGWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2/c1-9-5-4-6-12(7-9)15-10(2)8-13(11(15)3)14(16)17/h4-8H,1-3H3,(H,16,17).
What are the key properties of 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid?
2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid has a molecular weight of 229.28 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylic acid is sourced from PubChem (CID 2339295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).