C18H26ClN3O — CID 119628984
N-(2-amino-2-methylpropyl)-2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide;hydrochloride (PubChem CID 119628984) has the molecular formula C18H26ClN3O and a molecular weight of 335.88 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-2-methylpropyl)-2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119628984 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide;hydrochloride |
| SMILES | Cc1cccc(-n2c(C)cc(C(=O)NCC(C)(C)N)c2C)c1.Cl |
| InChI | InChI=1S/C18H25N3O.ClH/c1-12-7-6-8-15(9-12)21-13(2)10-16(14(21)3)17(22)20-11-18(4,5)19;/h6-10H,11,19H2,1-5H3,(H,20,22);1H |
| InChIKey | MYKUSGJLSYCVDC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|