C21H22N2O — CID 2423054
2,5-dimethyl-1-(3-methylphenyl)-N-(4-methylphenyl)pyrrole-3-carboxamide (PubChem CID 2423054) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 2,5-dimethyl-1-(3-methylphenyl)-N-(4-methylphenyl)pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-1-(3-methylphenyl)-N-(4-methylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 2423054 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2,5-dimethyl-1-(3-methylphenyl)-N-(4-methylphenyl)pyrrole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C)n(-c3cccc(C)c3)c2C)cc1 |
| InChI | InChI=1S/C21H22N2O/c1-14-8-10-18(11-9-14)22-21(24)20-13-16(3)23(17(20)4)19-7-5-6-15(2)12-19/h5-13H,1-4H3,(H,22,24) |
| InChIKey | BGFMLJRYKZBRRQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|