C24H23N3O3 — CID 60553560
N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide (PubChem CID 60553560) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide.
| Compound Name | N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 60553560 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(N3C(=O)CCCC3=O)cc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C24H23N3O3/c1-16-15-21(17(2)26(16)19-7-4-3-5-8-19)24(30)25-18-11-13-20(14-12-18)27-22(28)9-6-10-23(27)29/h3-5,7-8,11-15H,6,9-10H2,1-2H3,(H,25,30) |
| InChIKey | DGVOFTACOKQRHW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|