C20H17BrN2O2 — CID 22515509
N-(4-bromophenyl)-2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoacetamide (PubChem CID 22515509) has the molecular formula C20H17BrN2O2 and a molecular weight of 397.27 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoacetamide.
| Compound Name | N-(4-bromophenyl)-2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 22515509 |
| Molecular Formula | C20H17BrN2O2 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N-(4-bromophenyl)-2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoacetamide |
| SMILES | Cc1cc(C(=O)C(=O)Nc2ccc(Br)cc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H17BrN2O2/c1-13-12-18(14(2)23(13)17-6-4-3-5-7-17)19(24)20(25)22-16-10-8-15(21)9-11-16/h3-12H,1-2H3,(H,22,25) |
| InChIKey | HAIVKUPGLPCWEA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|